C20H34IN5O3S — CID 111347206
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111347206) has the molecular formula C20H34IN5O3S and a molecular weight of 551.50 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111347206 |
| Molecular Formula | C20H34IN5O3S |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)NCC(c1cccc(OC)c1)N1CCCC1.I |
| InChI | InChI=1S/C20H33N5O3S.HI/c1-21-20(22-9-13-25-12-6-14-29(25,26)27)23-16-19(24-10-3-4-11-24)17-7-5-8-18(15-17)28-2;/h5,7-8,15,19H,3-4,6,9-14,16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | AGVDUQABZOXMLE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|