C28H29NO5S — CID 11134746
(3aS,5R,6R,7S,7aR)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazole-2-thione (PubChem CID 11134746) has the molecular formula C28H29NO5S and a molecular weight of 491.61 g/mol. Its IUPAC name is (3aS,5R,6R,7S,7aR)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazole-2-thione.
| Compound Name | (3aS,5R,6R,7S,7aR)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazole-2-thione |
|---|---|
| PubChem CID | 11134746 |
| Molecular Formula | C28H29NO5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (3aS,5R,6R,7S,7aR)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazole-2-thione |
| SMILES | S=C1N[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C28H29NO5S/c35-28-29-27-26(34-28)25(32-18-22-14-8-3-9-15-22)24(31-17-21-12-6-2-7-13-21)23(33-27)19-30-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2,(H,29,35)/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | GUGCCQOYXXCIQU-SEFGFODJSA-N |
| XLogP | 4.37 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|