C23H37N5O — CID 111347560
N-cyclopropyl-4-[[N-methyl-C-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]butanamide (PubChem CID 111347560) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-methyl-C-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N-methyl-C-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111347560 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | N-cyclopropyl-4-[[N-methyl-C-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]carbonimidoyl]amino]butanamide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)N1CCN(Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H37N5O/c1-18(2)20-8-6-19(7-9-20)17-27-13-15-28(16-14-27)23(24-3)25-12-4-5-22(29)26-21-10-11-21/h6-9,18,21H,4-5,10-17H2,1-3H3,(H,24,25)(H,26,29) |
| InChIKey | YPFUZDBANYHPEB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|