C25H40N4O3 — CID 111348458
1-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine (PubChem CID 111348458) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111348458 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 1-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccc(OC)cc2)CCOCC1)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C25H40N4O3/c1-3-26-24(27-15-7-17-29-16-6-4-5-8-23(29)30)28-20-25(13-18-32-19-14-25)21-9-11-22(31-2)12-10-21/h9-12H,3-8,13-20H2,1-2H3,(H2,26,27,28) |
| InChIKey | UXYBALVDZCYDKF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|