C21H19FN8O4S — CID 11134857
4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride (PubChem CID 11134857) has the molecular formula C21H19FN8O4S and a molecular weight of 498.50 g/mol. Its IUPAC name is 4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride.
| Compound Name | 4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 11134857 |
| Molecular Formula | C21H19FN8O4S |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride |
| SMILES | CCCCn1cc2c(nc(NC(=O)Nc3ccc(S(=O)(=O)F)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H19FN8O4S/c1-2-3-10-29-12-15-17(27-29)25-20(30-19(15)24-18(28-30)16-5-4-11-34-16)26-21(31)23-13-6-8-14(9-7-13)35(22,32)33/h4-9,11-12H,2-3,10H2,1H3,(H2,23,25,26,27,31) |
| InChIKey | XZCCODAIRFTVIB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |