C20H36IN5OS — CID 111348723
2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111348723) has the molecular formula C20H36IN5OS and a molecular weight of 521.51 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111348723 |
| Molecular Formula | C20H36IN5OS |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(C(C)(C)C)n1)NCCCN1CCCCCC1=O.I |
| InChI | InChI=1S/C20H35N5OS.HI/c1-5-21-19(23-14-16-15-27-18(24-16)20(2,3)4)22-11-9-13-25-12-8-6-7-10-17(25)26;/h15H,5-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | BXIXPIXOLOMIPX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|