C30H52O4Si — CID 11134937
[(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-[tert-butyl(dimethyl)silyl]oxybutyl] 2,2-dimethylpropanoate (PubChem CID 11134937) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is [(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-[tert-butyl(dimethyl)silyl]oxybutyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-[tert-butyl(dimethyl)silyl]oxybutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11134937 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | [(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-[tert-butyl(dimethyl)silyl]oxybutyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@H]1O[C@@H]([C@@](C)(CCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C30H52O4Si/c1-14-15-23-24-21(4)16-17-22(20(2)3)25(24)26(33-23)30(11,34-35(12,13)29(8,9)10)18-19-32-27(31)28(5,6)7/h1,16,20,22-26H,15,17-19H2,2-13H3/t22-,23-,24-,25-,26-,30-/m1/s1 |
| InChIKey | JLTQRELCHVUXIY-AIIBPSNUSA-N |
| XLogP | 7.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|