C20H34N4O2S — CID 111349412
tert-butyl 3-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 111349412) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is tert-butyl 3-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111349412 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl 3-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCCN(C(=O)OC(C)(C)C)C1)NCCc1cccs1 |
| InChI | InChI=1S/C20H34N4O2S/c1-5-21-18(22-11-10-17-9-7-13-27-17)23-14-16-8-6-12-24(15-16)19(25)26-20(2,3)4/h7,9,13,16H,5-6,8,10-12,14-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | XBOOGKAKIIVNGR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|