C28H26ClNO6 — CID 11134978
ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-5-oxo-3-phenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate (PubChem CID 11134978) has the molecular formula C28H26ClNO6 and a molecular weight of 507.97 g/mol. Its IUPAC name is ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-5-oxo-3-phenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate.
| Compound Name | ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-5-oxo-3-phenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
|---|---|
| PubChem CID | 11134978 |
| Molecular Formula | C28H26ClNO6 |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | ethyl (4aR,7aR)-6-benzyl-3-(4-chlorophenyl)-7a-hydroxy-5-oxo-3-phenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrole-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CC(c3ccccc3)(c3ccc(Cl)cc3)OO[C@@]1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C28H26ClNO6/c1-2-34-25(32)26-18-27(21-11-7-4-8-12-21,22-13-15-23(29)16-14-22)35-36-28(26,33)19-30(24(26)31)17-20-9-5-3-6-10-20/h3-16,33H,2,17-19H2,1H3/t26-,27?,28+/m1/s1 |
| InChIKey | QZAONMDOKIYZSA-UNQNHFTRSA-N |
| XLogP | 4.22 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|