(4-aminophenyl)stibonic acid

C6H8NO3Sb — CID 11135

IUPAC(4-aminophenyl)stibonic acid
SMILESNc1ccc([Sb](=O)(O)O)cc1
InChIInChI=1S/C6H6N.2H2O.O.Sb/c7-6-4-2-1-3-5-6;;;;/h2-5H,7H2;2*1H2;;/q;;;;+2/p-2
InChIKeyNLPWTTIYIIOESZ-UHFFFAOYSA-L
MW263.89 g/mol
LogP-1.17
Rot. Bonds1

About (4-aminophenyl)stibonic acid

(4-aminophenyl)stibonic acid (PubChem CID 11135) has the molecular formula C6H8NO3Sb and a molecular weight of 263.89 g/mol. Its IUPAC name is (4-aminophenyl)stibonic acid.

Molecular Properties

Compound Name(4-aminophenyl)stibonic acid
PubChem CID11135
Molecular FormulaC6H8NO3Sb
Molecular Weight263.89 g/mol
Exact Mass262.95
IUPAC Name(4-aminophenyl)stibonic acid
SMILESNc1ccc([Sb](=O)(O)O)cc1
InChIInChI=1S/C6H6N.2H2O.O.Sb/c7-6-4-2-1-3-5-6;;;;/h2-5H,7H2;2*1H2;;/q;;;;+2/p-2
InChIKeyNLPWTTIYIIOESZ-UHFFFAOYSA-L
XLogP-1.17
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.89
LogP ≤ 5-1.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-aminophenyl)stibonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-aminophenyl)stibonic acid?
The IUPAC name of (4-aminophenyl)stibonic acid (CID 11135) is (4-aminophenyl)stibonic acid.
What is the SMILES notation for (4-aminophenyl)stibonic acid?
The canonical SMILES for (4-aminophenyl)stibonic acid is Nc1ccc([Sb](=O)(O)O)cc1.
What is the InChIKey of (4-aminophenyl)stibonic acid?
The InChIKey is NLPWTTIYIIOESZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H6N.2H2O.O.Sb/c7-6-4-2-1-3-5-6;;;;/h2-5H,7H2;2*1H2;;/q;;;;+2/p-2.
What are the key properties of (4-aminophenyl)stibonic acid?
(4-aminophenyl)stibonic acid has a molecular weight of 263.89 g/mol, XLogP of -1.17, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)stibonic acid is sourced from PubChem (CID 11135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).