C26H42O8Si — CID 11135001
tetraethyl (5E)-4-methylidene-5-(triethylsilylmethylidene)cyclohexane-1,1,2,2-tetracarboxylate (PubChem CID 11135001) has the molecular formula C26H42O8Si and a molecular weight of 510.70 g/mol. Its IUPAC name is tetraethyl (5E)-4-methylidene-5-(triethylsilylmethylidene)cyclohexane-1,1,2,2-tetracarboxylate.
| Compound Name | tetraethyl (5E)-4-methylidene-5-(triethylsilylmethylidene)cyclohexane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 11135001 |
| Molecular Formula | C26H42O8Si |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | tetraethyl (5E)-4-methylidene-5-(triethylsilylmethylidene)cyclohexane-1,1,2,2-tetracarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)C(C(=O)OCC)(C(=O)OCC)C/C1=C\[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H42O8Si/c1-9-31-21(27)25(22(28)32-10-2)16-19(8)20(18-35(13-5,14-6)15-7)17-26(25,23(29)33-11-3)24(30)34-12-4/h18H,8-17H2,1-7H3/b20-18+ |
| InChIKey | JTHXOTFFBIJCLE-CZIZESTLSA-N |
| XLogP | 4.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|