C29H46O6Si — CID 11135089
(1R,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-9-(2-ethoxyethynyl)-9-hydroxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalen-6-one (PubChem CID 11135089) has the molecular formula C29H46O6Si and a molecular weight of 518.77 g/mol. Its IUPAC name is (1R,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-9-(2-ethoxyethynyl)-9-hydroxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalen-6-one.
| Compound Name | (1R,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-9-(2-ethoxyethynyl)-9-hydroxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalen-6-one |
|---|---|
| PubChem CID | 11135089 |
| Molecular Formula | C29H46O6Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | (1R,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-9-(2-ethoxyethynyl)-9-hydroxy-2-methoxy-1-(2-methoxyethyl)-8,9a-dimethyl-1,2,3,5,5a,9b-hexahydrocyclopenta[a]naphthalen-6-one |
| SMILES | CCOC#C[C@]1(O)C(C)=CC(=O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@H](OC)[C@H](CCOC)[C@H]3[C@]21C |
| InChI | InChI=1S/C29H46O6Si/c1-11-34-15-13-29(31)19(2)16-23(30)22-18-25(35-36(9,10)27(3,4)5)21-17-24(33-8)20(12-14-32-7)26(21)28(22,29)6/h16,20,22,24,26,31H,11-12,14,17-18H2,1-10H3/t20-,22+,24-,26+,28-,29-/m0/s1 |
| InChIKey | BIXVMHIGQUNOEO-LOASEAGGSA-N |
| XLogP | 5.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|