C23H35N5S — CID 111351158
1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111351158) has the molecular formula C23H35N5S and a molecular weight of 413.64 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111351158 |
| Molecular Formula | C23H35N5S |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 1-ethyl-2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCN(C)CC2)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C23H35N5S/c1-3-24-23(25-12-11-22-6-4-17-29-22)26-18-20-7-9-21(10-8-20)19-28-14-5-13-27(2)15-16-28/h4,6-10,17H,3,5,11-16,18-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | QHFJCSFRCMGZPQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|