C17H24IN3O2S — CID 111351487
1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111351487) has the molecular formula C17H24IN3O2S and a molecular weight of 461.37 g/mol. Its IUPAC name is 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111351487 |
| Molecular Formula | C17H24IN3O2S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NCCc1cccs1.I |
| InChI | InChI=1S/C17H23N3O2S.HI/c1-3-18-17(19-10-9-14-7-5-11-23-14)20-12-13-6-4-8-15(22-2)16(13)21;/h4-8,11,21H,3,9-10,12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | OUHNGBZQRJNULT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|