C25H39NO9S — CID 11135211
[(1R,2R,3R,4R,5S,6S,8R,9R,13R,17S,18R)-11-ethyl-5,8-dihydroxy-6,18-dimethoxy-13-(methoxymethyl)-14-oxo-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate (PubChem CID 11135211) has the molecular formula C25H39NO9S and a molecular weight of 529.65 g/mol. Its IUPAC name is [(1R,2R,3R,4R,5S,6S,8R,9R,13R,17S,18R)-11-ethyl-5,8-dihydroxy-6,18-dimethoxy-13-(methoxymethyl)-14-oxo-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate.
| Compound Name | [(1R,2R,3R,4R,5S,6S,8R,9R,13R,17S,18R)-11-ethyl-5,8-dihydroxy-6,18-dimethoxy-13-(methoxymethyl)-14-oxo-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 11135211 |
| Molecular Formula | C25H39NO9S |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | [(1R,2R,3R,4R,5S,6S,8R,9R,13R,17S,18R)-11-ethyl-5,8-dihydroxy-6,18-dimethoxy-13-(methoxymethyl)-14-oxo-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] methanesulfonate |
| SMILES | CCN1C[C@]2(COC)C(=O)CC[C@]34C1[C@H]([C@H](OC)[C@H]23)[C@@]1(O)C[C@H](OC)[C@@]2(O)C[C@@H]4[C@@H]1[C@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C25H39NO9S/c1-6-26-11-22(12-32-2)14(27)7-8-23-13-9-24(28)15(33-3)10-25(29,16(13)21(24)35-36(5,30)31)17(20(23)26)18(34-4)19(22)23/h13,15-21,28-29H,6-12H2,1-5H3/t13-,15+,16-,17+,18+,19-,20?,21-,22+,23-,24+,25-/m1/s1 |
| InChIKey | UJGUFKXYJNGFEO-PPYLYOFFSA-N |
| XLogP | -0.19 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|