C26H30N6O — CID 111352528
2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine (PubChem CID 111352528) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111352528 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1ccnc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H30N6O/c1-20-31-23-11-6-7-12-24(23)32(20)16-8-14-29-26(27-2)30-18-22-13-15-28-25(17-22)33-19-21-9-4-3-5-10-21/h3-7,9-13,15,17H,8,14,16,18-19H2,1-2H3,(H2,27,29,30) |
| InChIKey | RWDMPONQWUVALW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|