C31H30F3NO4 — CID 11135300
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 11135300) has the molecular formula C31H30F3NO4 and a molecular weight of 537.58 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11135300 |
| Molecular Formula | C31H30F3NO4 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H30F3NO4/c1-38-29(36)19-12-22-6-5-9-27(20-22)35(30(37)26-7-3-2-4-8-26)21-23-10-13-24(14-11-23)25-15-17-28(18-16-25)39-31(32,33)34/h5-6,9-20,26H,2-4,7-8,21H2,1H3/b19-12+ |
| InChIKey | APYBDLRDIDVHIU-XDHOZWIPSA-N |
| XLogP | 7.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|