C26H37IN6O — CID 111353315
N-tert-butyl-3-[[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111353315) has the molecular formula C26H37IN6O and a molecular weight of 576.53 g/mol. Its IUPAC name is N-tert-butyl-3-[[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-tert-butyl-3-[[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111353315 |
| Molecular Formula | C26H37IN6O |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | N-tert-butyl-3-[[[ethylamino-[3-(2-methylbenzimidazol-1-yl)propylamino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)(C)C)c1)NCCCn1c(C)nc2ccccc21.I |
| InChI | InChI=1S/C26H36N6O.HI/c1-6-27-25(28-15-10-16-32-19(2)30-22-13-7-8-14-23(22)32)29-18-20-11-9-12-21(17-20)24(33)31-26(3,4)5;/h7-9,11-14,17H,6,10,15-16,18H2,1-5H3,(H,31,33)(H2,27,28,29);1H |
| InChIKey | PQJPLGZANYUTTD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|