C25H34O13 — CID 11135334
[(1S,2S,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 11135334) has the molecular formula C25H34O13 and a molecular weight of 542.53 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [(1S,2S,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11135334 |
| Molecular Formula | C25H34O13 |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(1S,2S,4S,5R,6S,7S,9R,12R)-4,5,7,12-tetraacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12[C@H](OC(C)=O)C(=O)[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@@](C)(O)C[C@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C25H34O13/c1-11(26)33-10-24-19(35-13(3)28)16(34-12(2)27)9-23(8,32)25(24)20(36-14(4)29)17(22(6,7)38-25)18(31)21(24)37-15(5)30/h16-17,19-21,32H,9-10H2,1-8H3/t16-,17+,19-,20+,21+,23-,24-,25-/m0/s1 |
| InChIKey | CWRZFIYRBDBWBH-XVHYGRDOSA-N |
| XLogP | 0.16 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|