C30H54N6O3 — CID 11135374
1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 11135374) has the molecular formula C30H54N6O3 and a molecular weight of 546.80 g/mol. Its IUPAC name is 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 11135374 |
| Molecular Formula | C30H54N6O3 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | 1,3,5-tris(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC1(C)CC(n2c(=O)n(C3CC(C)(C)NC(C)(C)C3)c(=O)n(C3CC(C)(C)NC(C)(C)C3)c2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C30H54N6O3/c1-25(2)13-19(14-26(3,4)31-25)34-22(37)35(20-15-27(5,6)32-28(7,8)16-20)24(39)36(23(34)38)21-17-29(9,10)33-30(11,12)18-21/h19-21,31-33H,13-18H2,1-12H3 |
| InChIKey | BUWLWJBCDAHLKW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |