C19H34IN3O3 — CID 111354793
1-butyl-3-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111354793) has the molecular formula C19H34IN3O3 and a molecular weight of 479.40 g/mol. Its IUPAC name is 1-butyl-3-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111354793 |
| Molecular Formula | C19H34IN3O3 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-butyl-3-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\CCCOCC1CCCO1)NCCc1ccco1.I |
| InChI | InChI=1S/C19H33N3O3.HI/c1-2-3-10-20-19(22-12-9-17-7-4-14-24-17)21-11-6-13-23-16-18-8-5-15-25-18;/h4,7,14,18H,2-3,5-6,8-13,15-16H2,1H3,(H2,20,21,22);1H |
| InChIKey | OFBWWMRIJRJEOG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|