C16H22F12O4Si2 — CID 11135496
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (2S,3S)-2,3-bis(trimethylsilyl)butanedioate (PubChem CID 11135496) has the molecular formula C16H22F12O4Si2 and a molecular weight of 562.50 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (2S,3S)-2,3-bis(trimethylsilyl)butanedioate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (2S,3S)-2,3-bis(trimethylsilyl)butanedioate |
|---|---|
| PubChem CID | 11135496 |
| Molecular Formula | C16H22F12O4Si2 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) (2S,3S)-2,3-bis(trimethylsilyl)butanedioate |
| SMILES | C[Si](C)(C)[C@@H](C(=O)OC(C(F)(F)F)C(F)(F)F)[C@H](C(=O)OC(C(F)(F)F)C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C16H22F12O4Si2/c1-33(2,3)7(9(29)31-11(13(17,18)19)14(20,21)22)8(34(4,5)6)10(30)32-12(15(23,24)25)16(26,27)28/h7-8,11-12H,1-6H3/t7-,8-/m1/s1 |
| InChIKey | GGZJBMNZEAGZAD-HTQZYQBOSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|