C14H26IN3O — CID 111355969
1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide (PubChem CID 111355969) has the molecular formula C14H26IN3O and a molecular weight of 379.29 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111355969 |
| Molecular Formula | C14H26IN3O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)C)NCCc1ccco1.I |
| InChI | InChI=1S/C14H25N3O.HI/c1-12(2)6-4-9-16-14(15-3)17-10-8-13-7-5-11-18-13;/h5,7,11-12H,4,6,8-10H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | OFGYAAGGKDXSNI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|