C30H42O11 — CID 11135613
[(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl] butanoate (PubChem CID 11135613) has the molecular formula C30H42O11 and a molecular weight of 578.66 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl] butanoate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl] butanoate |
|---|---|
| PubChem CID | 11135613 |
| Molecular Formula | C30H42O11 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,10R,12R,13R,14S)-2,12,14-triacetyloxy-3-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-10-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1C[C@@H](OC(C)=O)[C@@]2(C)[C@@H](OC(C)=O)CC=C(C)[C@@H]2[C@@H](OC(C)=O)[C@@]2(O)[C@H](/C=C\1C)OC(=O)[C@@H]2C |
| InChI | InChI=1S/C30H42O11/c1-9-10-25(34)40-21-14-23(38-19(6)32)29(8)22(37-18(5)31)12-11-15(2)26(29)27(39-20(7)33)30(36)17(4)28(35)41-24(30)13-16(21)3/h11,13,17,21-24,26-27,36H,9-10,12,14H2,1-8H3/b16-13-/t17-,21+,22-,23+,24-,26+,27+,29+,30-/m0/s1 |
| InChIKey | YABKAVBLXPBVRQ-DZXSCAIYSA-N |
| XLogP | 3.11 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|