C33H31N3O7 — CID 11135635
methyl 2-(4-aminophenyl)-1-oxo-7-(2-pyridin-2-ylethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate (PubChem CID 11135635) has the molecular formula C33H31N3O7 and a molecular weight of 581.63 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-1-oxo-7-(2-pyridin-2-ylethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-1-oxo-7-(2-pyridin-2-ylethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11135635 |
| Molecular Formula | C33H31N3O7 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | methyl 2-(4-aminophenyl)-1-oxo-7-(2-pyridin-2-ylethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc(OCCc3ccccn3)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C33H31N3O7/c1-39-27-17-20(18-28(40-2)31(27)41-3)29-25-13-12-24(43-16-14-22-7-5-6-15-35-22)19-26(25)32(37)36(30(29)33(38)42-4)23-10-8-21(34)9-11-23/h5-13,15,17-19H,14,16,34H2,1-4H3 |
| InChIKey | WVEJYIOIISSSGG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|