C23H33N3O2 — CID 111356952
2-(2,2-diphenylethyl)-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine (PubChem CID 111356952) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-(2,2-diphenylethyl)-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine.
| Compound Name | 2-(2,2-diphenylethyl)-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111356952 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 2-(2,2-diphenylethyl)-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)c1ccccc1)NCCCOCCOC |
| InChI | InChI=1S/C23H33N3O2/c1-3-24-23(25-15-10-16-28-18-17-27-2)26-19-22(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-14,22H,3,10,15-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | CQOQGYHRODUHQB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|