C18H27ClN4O — CID 111357730
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine (PubChem CID 111357730) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111357730 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H27ClN4O/c1-2-20-18(21-10-9-15-7-6-8-16(19)13-15)22-14-17(24)23-11-4-3-5-12-23/h6-8,13H,2-5,9-12,14H2,1H3,(H2,20,21,22) |
| InChIKey | DJBWHUIPBOQAAJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|