C17H21ClN4O — CID 111357844
1-[2-(3-chlorophenyl)ethyl]-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine (PubChem CID 111357844) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111357844 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[(6-methoxy-3-pyridinyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCc1ccc(OC)nc1 |
| InChI | InChI=1S/C17H21ClN4O/c1-19-17(20-9-8-13-4-3-5-15(18)10-13)22-12-14-6-7-16(23-2)21-11-14/h3-7,10-11H,8-9,12H2,1-2H3,(H2,19,20,22) |
| InChIKey | RKADDGSYUIKAAF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|