C20H23ClIN5 — CID 111357901
1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111357901) has the molecular formula C20H23ClIN5 and a molecular weight of 495.80 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111357901 |
| Molecular Formula | C20H23ClIN5 |
| Molecular Weight | 495.80 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C20H22ClN5.HI/c1-22-20(23-12-10-16-4-2-5-18(21)14-16)24-15-17-6-8-19(9-7-17)26-13-3-11-25-26;/h2-9,11,13-14H,10,12,15H2,1H3,(H2,22,23,24);1H |
| InChIKey | AUFBBYVVLJMWLK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|