C15H24N4O — CID 111360785
N-ethyl-2-[[N-ethyl-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111360785) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N-ethyl-2-[[N-ethyl-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-ethyl-2-[[N-ethyl-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111360785 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-ethyl-2-[[N-ethyl-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | CCNC(=O)CN/C(=N/Cc1ccccc1C)NCC |
| InChI | InChI=1S/C15H24N4O/c1-4-16-14(20)11-19-15(17-5-2)18-10-13-9-7-6-8-12(13)3/h6-9H,4-5,10-11H2,1-3H3,(H,16,20)(H2,17,18,19) |
| InChIKey | ATDOOQZRLKVZFT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|