C43H43NO6 — CID 11136133
benzyl N-[(1S,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-2-en-1-yl]carbamate (PubChem CID 11136133) has the molecular formula C43H43NO6 and a molecular weight of 669.82 g/mol. Its IUPAC name is benzyl N-[(1S,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-2-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1S,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 11136133 |
| Molecular Formula | C43H43NO6 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | benzyl N-[(1S,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-2-en-1-yl]carbamate |
| SMILES | O=C(N[C@H]1C=C(COCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C43H43NO6/c45-43(50-31-37-24-14-5-15-25-37)44-39-26-38(32-46-27-33-16-6-1-7-17-33)40(47-28-34-18-8-2-9-19-34)42(49-30-36-22-12-4-13-23-36)41(39)48-29-35-20-10-3-11-21-35/h1-26,39-42H,27-32H2,(H,44,45)/t39-,40?,41-,42-/m0/s1 |
| InChIKey | QGXDGABZPCIHNP-UNVUURPQSA-N |
| XLogP | 8.19 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|