C17H24FIN4S — CID 111361624
1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111361624) has the molecular formula C17H24FIN4S and a molecular weight of 462.38 g/mol. Its IUPAC name is 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111361624 |
| Molecular Formula | C17H24FIN4S |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NCCc2ccccc2F)cs1.I |
| InChI | InChI=1S/C17H23FN4S.HI/c1-3-16-22-14(12-23-16)9-11-21-17(19-2)20-10-8-13-6-4-5-7-15(13)18;/h4-7,12H,3,8-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | MEVJXJKPSCRKJV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|