C19H28FIN4S — CID 111362166
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111362166) has the molecular formula C19H28FIN4S and a molecular weight of 490.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111362166 |
| Molecular Formula | C19H28FIN4S |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(C(C)C)n1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C19H27FN4S.HI/c1-4-21-19(22-11-9-15-7-5-6-8-17(15)20)23-12-10-16-13-25-18(24-16)14(2)3;/h5-8,13-14H,4,9-12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZFROGSDAUURXPI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|