C19H26FIN4O2 — CID 111362304
1-[2-(2-fluorophenyl)ethyl]-3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111362304) has the molecular formula C19H26FIN4O2 and a molecular weight of 488.35 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111362304 |
| Molecular Formula | C19H26FIN4O2 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-3-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCc1ccc(OCCOC)nc1.I |
| InChI | InChI=1S/C19H25FN4O2.HI/c1-21-19(22-10-9-16-5-3-4-6-17(16)20)24-14-15-7-8-18(23-13-15)26-12-11-25-2;/h3-8,13H,9-12,14H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | HERSVZCANCDJTD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|