C26H35IO17 — CID 11136400
[(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-iodo-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 11136400) has the molecular formula C26H35IO17 and a molecular weight of 746.45 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-iodo-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-iodo-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11136400 |
| Molecular Formula | C26H35IO17 |
| Molecular Weight | 746.45 g/mol |
| Exact Mass | 746.09 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,6-diacetyloxy-5-iodo-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](OC(C)=O)[C@H](I)[C@@H](OC(C)=O)O[C@@H]2COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H35IO17/c1-10(28)35-8-17-20(22(38-13(4)31)19(27)25(42-17)41-16(7)34)44-26-24(40-15(6)33)23(39-14(5)32)21(37-12(3)30)18(43-26)9-36-11(2)29/h17-26H,8-9H2,1-7H3/t17-,18-,19+,20-,21+,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | OFSLTBJMMQUWQJ-SURUERECSA-N |
| XLogP | 0.04 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|