C40H48Br2N4O4 — CID 11136555
3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-[6-[3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide (PubChem CID 11136555) has the molecular formula C40H48Br2N4O4 and a molecular weight of 808.66 g/mol. Its IUPAC name is 3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-[6-[3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide.
| Compound Name | 3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-[6-[3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 11136555 |
| Molecular Formula | C40H48Br2N4O4 |
| Molecular Weight | 808.66 g/mol |
| Exact Mass | 806.20 |
| IUPAC Name | 3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-[6-[3-(1,3-dioxobenzo[f]isoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium dibromide |
| SMILES | C[N+](C)(CCCCCC[N+](C)(C)CCCN1C(=O)c2cc3ccccc3cc2C1=O)CCCN1C(=O)c2cc3ccccc3cc2C1=O.[Br-].[Br-] |
| InChI | InChI=1S/C40H48N4O4.2BrH/c1-43(2,23-13-19-41-37(45)33-25-29-15-7-8-16-30(29)26-34(33)38(41)46)21-11-5-6-12-22-44(3,4)24-14-20-42-39(47)35-27-31-17-9-10-18-32(31)28-36(35)40(42)48;;/h7-10,15-18,25-28H,5-6,11-14,19-24H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | YNUKMGDEWHYQPE-UHFFFAOYSA-L |
| XLogP | 0.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.66 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|