C18H30IN5O2 — CID 111365800
3-[[[[[2-(dimethylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide (PubChem CID 111365800) has the molecular formula C18H30IN5O2 and a molecular weight of 475.38 g/mol. Its IUPAC name is 3-[[[[[2-(dimethylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide.
| Compound Name | 3-[[[[[2-(dimethylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111365800 |
| Molecular Formula | C18H30IN5O2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-[[[[[2-(dimethylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-propylbenzamide;hydroiodide |
| SMILES | CCCNC(=O)c1cccc(C/N=C(\NCC)NCC(=O)N(C)C)c1.I |
| InChI | InChI=1S/C18H29N5O2.HI/c1-5-10-20-17(25)15-9-7-8-14(11-15)12-21-18(19-6-2)22-13-16(24)23(3)4;/h7-9,11H,5-6,10,12-13H2,1-4H3,(H,20,25)(H2,19,21,22);1H |
| InChIKey | NIFCFLDHMZUEGN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|