C17H30F3N5O — CID 111365875
2-[[(cyclohexylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111365875) has the molecular formula C17H30F3N5O and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111365875 |
| Molecular Formula | C17H30F3N5O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 2-[[(cyclohexylamino)-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C17H30F3N5O/c1-24(2)15(26)10-21-16(22-13-6-4-3-5-7-13)23-14-8-9-25(11-14)12-17(18,19)20/h13-14H,3-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | KVGPGJLNGLMIHU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|