C21H30N6O — CID 1113670
N-(4-ethoxyphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 1113670) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(4-ethoxyphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1113670 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | N-(4-ethoxyphenyl)-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C21H30N6O/c1-2-28-18-11-9-17(10-12-18)22-19-23-20(26-13-5-3-6-14-26)25-21(24-19)27-15-7-4-8-16-27/h9-12H,2-8,13-16H2,1H3,(H,22,23,24,25) |
| InChIKey | MATPYEQHJKYWGO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |