C17H22N6O3 — CID 1113672
3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenol (PubChem CID 1113672) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenol.
| Compound Name | 3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenol |
|---|---|
| PubChem CID | 1113672 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenol |
| SMILES | Oc1cccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C17H22N6O3/c24-14-3-1-2-13(12-14)18-15-19-16(22-4-8-25-9-5-22)21-17(20-15)23-6-10-26-11-7-23/h1-3,12,24H,4-11H2,(H,18,19,20,21) |
| InChIKey | ZHKSHBSAJCOKAP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |