C15H31IN4O3 — CID 111368840
methyl 3-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111368840) has the molecular formula C15H31IN4O3 and a molecular weight of 442.34 g/mol. Its IUPAC name is methyl 3-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111368840 |
| Molecular Formula | C15H31IN4O3 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | methyl 3-[[N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)NCC1CN(CC(C)C)CCO1.I |
| InChI | InChI=1S/C15H30N4O3.HI/c1-12(2)10-19-7-8-22-13(11-19)9-18-15(16-3)17-6-5-14(20)21-4;/h12-13H,5-11H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | BXZWJQLNXOLLRB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|