C22H38IN5O2 — CID 111369186
2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-ethyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111369186) has the molecular formula C22H38IN5O2 and a molecular weight of 531.48 g/mol. Its IUPAC name is 2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-ethyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-ethyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111369186 |
| Molecular Formula | C22H38IN5O2 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 2-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-1-ethyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC2CC2)nc1)NCC1CN(CC(C)C)CCO1.I |
| InChI | InChI=1S/C22H37N5O2.HI/c1-4-23-22(26-13-20-15-27(9-10-28-20)14-17(2)3)25-12-19-7-8-21(24-11-19)29-16-18-5-6-18;/h7-8,11,17-18,20H,4-6,9-10,12-16H2,1-3H3,(H2,23,25,26);1H |
| InChIKey | BWVYHWZNLBGBBJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|