C21H33N5O3 — CID 111369731
1-(2-methylprop-2-enyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 111369731) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1-(2-methylprop-2-enyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111369731 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | C=C(C)CN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C21H33N5O3/c1-16(2)11-22-21(23-12-18-5-7-19(8-6-18)26(27)28)24-13-20-15-25(9-10-29-20)14-17(3)4/h5-8,17,20H,1,9-15H2,2-4H3,(H2,22,23,24) |
| InChIKey | JOYORAKGGQHVGV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|