C18H22O8 — CID 11137015
tetramethyl 5-(2,2-dimethylpropylidene)cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 11137015) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is tetramethyl 5-(2,2-dimethylpropylidene)cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 5-(2,2-dimethylpropylidene)cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 11137015 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | tetramethyl 5-(2,2-dimethylpropylidene)cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C1=CC(C)(C)C |
| InChI | InChI=1S/C18H22O8/c1-18(2,3)8-9-10(14(19)23-4)12(16(21)25-6)13(17(22)26-7)11(9)15(20)24-5/h8H,1-7H3 |
| InChIKey | FJJCTNNGPFGFBC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|