C7H10 — CID 11137094
1,3-dimethylcyclopenta-1,3-diene (PubChem CID 11137094) has the molecular formula C7H10 and a molecular weight of 94.16 g/mol. Its IUPAC name is 1,3-dimethylcyclopenta-1,3-diene.
| Compound Name | 1,3-dimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11137094 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | 1,3-dimethylcyclopenta-1,3-diene |
| SMILES | CC1=CCC(C)=C1 |
| InChI | InChI=1S/C7H10/c1-6-3-4-7(2)5-6/h3,5H,4H2,1-2H3 |
| InChIKey | YPEOCTSXLWIZSO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |