C17H35N5O — CID 111371125
2-methyl-N-[2-[[N'-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]propanamide (PubChem CID 111371125) has the molecular formula C17H35N5O and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 111371125 |
| Molecular Formula | C17H35N5O |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]carbamimidoyl]amino]ethyl]propanamide |
| SMILES | C/N=C(/NCCCN1CCCCC1C)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C17H35N5O/c1-14(2)16(23)19-10-11-21-17(18-4)20-9-7-13-22-12-6-5-8-15(22)3/h14-15H,5-13H2,1-4H3,(H,19,23)(H2,18,20,21) |
| InChIKey | QQJMWEXCLORNSX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|