About lithium 3,3-dimethoxyprop-1-ene
lithium 3,3-dimethoxyprop-1-ene (PubChem CID 11137115) has the molecular formula C5H9LiO2
and a molecular weight of 108.07 g/mol. Its IUPAC name is lithium 3,3-dimethoxyprop-1-ene.
Molecular Properties
| Compound Name | lithium 3,3-dimethoxyprop-1-ene |
| PubChem CID | 11137115 |
| Molecular Formula | C5H9LiO2 |
| Molecular Weight | 108.07 g/mol |
| Exact Mass | 108.08 |
| IUPAC Name | lithium 3,3-dimethoxyprop-1-ene |
| SMILES | C=[C-]C(OC)OC.[Li+] |
| InChI | InChI=1S/C5H9O2.Li/c1-4-5(6-2)7-3;/h5H,1H2,2-3H3;/q-1;+1 |
| InChIKey | MSDSNJXIPIGKJV-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.07 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium 3,3-dimethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3,3-dimethoxyprop-1-ene?
The IUPAC name of lithium 3,3-dimethoxyprop-1-ene (CID 11137115) is lithium 3,3-dimethoxyprop-1-ene.
What is the SMILES notation for lithium 3,3-dimethoxyprop-1-ene?
The canonical SMILES for lithium 3,3-dimethoxyprop-1-ene is C=[C-]C(OC)OC.[Li+].
What is the InChIKey of lithium 3,3-dimethoxyprop-1-ene?
The InChIKey is MSDSNJXIPIGKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O2.Li/c1-4-5(6-2)7-3;/h5H,1H2,2-3H3;/q-1;+1.
What are the key properties of lithium 3,3-dimethoxyprop-1-ene?
lithium 3,3-dimethoxyprop-1-ene has a molecular weight of 108.07 g/mol, XLogP of -2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3,3-dimethoxyprop-1-ene is sourced from PubChem (CID 11137115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).