About 2-ethenyl-5-ethylfuran
2-ethenyl-5-ethylfuran (PubChem CID 11137159) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-ethenyl-5-ethylfuran.
Molecular Properties
| Compound Name | 2-ethenyl-5-ethylfuran |
| PubChem CID | 11137159 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2-ethenyl-5-ethylfuran |
| SMILES | C=Cc1ccc(CC)o1 |
| InChI | InChI=1S/C8H10O/c1-3-7-5-6-8(4-2)9-7/h3,5-6H,1,4H2,2H3 |
| InChIKey | IXUQNBIJEOYXFG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-5-ethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-5-ethylfuran?
The IUPAC name of 2-ethenyl-5-ethylfuran (CID 11137159) is 2-ethenyl-5-ethylfuran.
What is the SMILES notation for 2-ethenyl-5-ethylfuran?
The canonical SMILES for 2-ethenyl-5-ethylfuran is C=Cc1ccc(CC)o1.
What is the InChIKey of 2-ethenyl-5-ethylfuran?
The InChIKey is IXUQNBIJEOYXFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-3-7-5-6-8(4-2)9-7/h3,5-6H,1,4H2,2H3.
What are the key properties of 2-ethenyl-5-ethylfuran?
2-ethenyl-5-ethylfuran has a molecular weight of 122.17 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-5-ethylfuran is sourced from PubChem (CID 11137159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).