C6H12O3 — CID 11137206
cis-(1R,3S)-2-methylcyclopentane-1,2,3-triol (PubChem CID 11137206) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is cis-(1R,3S)-2-methylcyclopentane-1,2,3-triol.
| Compound Name | cis-(1R,3S)-2-methylcyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 11137206 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | cis-(1R,3S)-2-methylcyclopentane-1,2,3-triol |
| SMILES | CC1(O)[C@H](O)CC[C@@H]1O |
| InChI | InChI=1S/C6H12O3/c1-6(9)4(7)2-3-5(6)8/h4-5,7-9H,2-3H2,1H3/t4-,5+,6? |
| InChIKey | VTDKJKUKALZPAM-XEAPYIEGSA-N |
| XLogP | -0.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |