C16H26IN3O2S — CID 111372404
propan-2-yl 3-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111372404) has the molecular formula C16H26IN3O2S and a molecular weight of 451.37 g/mol. Its IUPAC name is propan-2-yl 3-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111372404 |
| Molecular Formula | C16H26IN3O2S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | propan-2-yl 3-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(/NCCSc1ccccc1)NCCC(=O)OC(C)C.I |
| InChI | InChI=1S/C16H25N3O2S.HI/c1-13(2)21-15(20)9-10-18-16(17-3)19-11-12-22-14-7-5-4-6-8-14;/h4-8,13H,9-12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | YXJOTPJCQWFBIU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|